C19H21N5O4S — CID 22608570
3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-(2-sulfanylphenyl)propanoic acid (PubChem CID 22608570) has the molecular formula C19H21N5O4S and a molecular weight of 415.48 g/mol. Its IUPAC name is 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-(2-sulfanylphenyl)propanoic acid.
| Compound Name | 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-(2-sulfanylphenyl)propanoic acid |
|---|---|
| PubChem CID | 22608570 |
| Molecular Formula | C19H21N5O4S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-(2-sulfanylphenyl)propanoic acid |
| SMILES | NC(N)=Nc1cccc(C(=O)NCC(=O)NC(CC(=O)O)c2ccccc2S)c1 |
| InChI | InChI=1S/C19H21N5O4S/c20-19(21)23-12-5-3-4-11(8-12)18(28)22-10-16(25)24-14(9-17(26)27)13-6-1-2-7-15(13)29/h1-8,14,29H,9-10H2,(H,22,28)(H,24,25)(H,26,27)(H4,20,21,23) |
| InChIKey | QECBPLSPAHITGJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|