C19H23N5O3 — CID 70072609
3-[[3-(diaminomethylideneamino)benzoyl]amino]-3-[2-(dimethylamino)phenyl]propanoic acid (PubChem CID 70072609) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is 3-[[3-(diaminomethylideneamino)benzoyl]amino]-3-[2-(dimethylamino)phenyl]propanoic acid.
| Compound Name | 3-[[3-(diaminomethylideneamino)benzoyl]amino]-3-[2-(dimethylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 70072609 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 3-[[3-(diaminomethylideneamino)benzoyl]amino]-3-[2-(dimethylamino)phenyl]propanoic acid |
| SMILES | CN(C)c1ccccc1C(CC(=O)O)NC(=O)c1cccc(N=C(N)N)c1 |
| InChI | InChI=1S/C19H23N5O3/c1-24(2)16-9-4-3-8-14(16)15(11-17(25)26)23-18(27)12-6-5-7-13(10-12)22-19(20)21/h3-10,15H,11H2,1-2H3,(H,23,27)(H,25,26)(H4,20,21,22) |
| InChIKey | PEYKBJFZMPXDNK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 134.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|