C23H22N4O4 — CID 22268590
3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]phenoxy]-3-phenylpropanoic acid (PubChem CID 22268590) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is 3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]phenoxy]-3-phenylpropanoic acid.
| Compound Name | 3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]phenoxy]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 22268590 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]phenoxy]-3-phenylpropanoic acid |
| SMILES | NC(N)=Nc1cccc(C(=O)Nc2ccc(OC(CC(=O)O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C23H22N4O4/c24-23(25)27-18-8-4-7-16(13-18)22(30)26-17-9-11-19(12-10-17)31-20(14-21(28)29)15-5-2-1-3-6-15/h1-13,20H,14H2,(H,26,30)(H,28,29)(H4,24,25,27) |
| InChIKey | BCJZFXPPRBHWNR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|