C18H20N4O4 — CID 70184626
carbonic acid;N-(4-cyclopropylphenyl)-3-(diaminomethylideneamino)benzamide (PubChem CID 70184626) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is carbonic acid;N-(4-cyclopropylphenyl)-3-(diaminomethylideneamino)benzamide.
| Compound Name | carbonic acid;N-(4-cyclopropylphenyl)-3-(diaminomethylideneamino)benzamide |
|---|---|
| PubChem CID | 70184626 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | carbonic acid;N-(4-cyclopropylphenyl)-3-(diaminomethylideneamino)benzamide |
| SMILES | NC(N)=Nc1cccc(C(=O)Nc2ccc(C3CC3)cc2)c1.O=C(O)O |
| InChI | InChI=1S/C17H18N4O.CH2O3/c18-17(19)21-15-3-1-2-13(10-15)16(22)20-14-8-6-12(7-9-14)11-4-5-11;2-1(3)4/h1-3,6-11H,4-5H2,(H,20,22)(H4,18,19,21);(H2,2,3,4) |
| InChIKey | UNAMFUDEJIJGCB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 151.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|