C17H14Cl2N4O3 — CID 54134908
3-[2,6-dichloro-4-[[3-(diaminomethylideneamino)benzoyl]amino]phenyl]prop-2-enoic acid (PubChem CID 54134908) has the molecular formula C17H14Cl2N4O3 and a molecular weight of 393.23 g/mol. Its IUPAC name is 3-[2,6-dichloro-4-[[3-(diaminomethylideneamino)benzoyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | 3-[2,6-dichloro-4-[[3-(diaminomethylideneamino)benzoyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 54134908 |
| Molecular Formula | C17H14Cl2N4O3 |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 3-[2,6-dichloro-4-[[3-(diaminomethylideneamino)benzoyl]amino]phenyl]prop-2-enoic acid |
| SMILES | NC(N)=Nc1cccc(C(=O)Nc2cc(Cl)c(C=CC(=O)O)c(Cl)c2)c1 |
| InChI | InChI=1S/C17H14Cl2N4O3/c18-13-7-11(8-14(19)12(13)4-5-15(24)25)22-16(26)9-2-1-3-10(6-9)23-17(20)21/h1-8H,(H,22,26)(H,24,25)(H4,20,21,23) |
| InChIKey | NWZLNEWWMODGBE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|