C17H18N5O3W- — CID 59959764
[1-carboxy-2-[4-[[3-(diaminomethylideneamino)benzoyl]amino]phenyl]ethyl]azanide;tungsten (PubChem CID 59959764) has the molecular formula C17H18N5O3W- and a molecular weight of 524.20 g/mol. Its IUPAC name is [1-carboxy-2-[4-[[3-(diaminomethylideneamino)benzoyl]amino]phenyl]ethyl]azanide;tungsten.
| Compound Name | [1-carboxy-2-[4-[[3-(diaminomethylideneamino)benzoyl]amino]phenyl]ethyl]azanide;tungsten |
|---|---|
| PubChem CID | 59959764 |
| Molecular Formula | C17H18N5O3W- |
| Molecular Weight | 524.20 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | [1-carboxy-2-[4-[[3-(diaminomethylideneamino)benzoyl]amino]phenyl]ethyl]azanide;tungsten |
| SMILES | [NH-]C(Cc1ccc(NC(=O)c2cccc(N=C(N)N)c2)cc1)C(=O)O.[W] |
| InChI | InChI=1S/C17H18N5O3.W/c18-14(16(24)25)8-10-4-6-12(7-5-10)21-15(23)11-2-1-3-13(9-11)22-17(19)20;/h1-7,9,14,18H,8H2,(H,21,23)(H,24,25)(H4,19,20,22);/q-1; |
| InChIKey | MISMTVBEAXZVHA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 154.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|