C22H28N6O4 — CID 135723165
propan-2-yl N-[1-[4-[[3-[[amino-(carbamoylamino)methylidene]amino]benzoyl]amino]phenyl]propan-2-yl]carbamate (PubChem CID 135723165) has the molecular formula C22H28N6O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is propan-2-yl N-[1-[4-[[3-[[amino-(carbamoylamino)methylidene]amino]benzoyl]amino]phenyl]propan-2-yl]carbamate.
| Compound Name | propan-2-yl N-[1-[4-[[3-[[amino-(carbamoylamino)methylidene]amino]benzoyl]amino]phenyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 135723165 |
| Molecular Formula | C22H28N6O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | propan-2-yl N-[1-[4-[[3-[[amino-(carbamoylamino)methylidene]amino]benzoyl]amino]phenyl]propan-2-yl]carbamate |
| SMILES | CC(Cc1ccc(NC(=O)c2cccc(/N=C(\N)NC(N)=O)c2)cc1)NC(=O)OC(C)C |
| InChI | InChI=1S/C22H28N6O4/c1-13(2)32-22(31)25-14(3)11-15-7-9-17(10-8-15)26-19(29)16-5-4-6-18(12-16)27-20(23)28-21(24)30/h4-10,12-14H,11H2,1-3H3,(H,25,31)(H,26,29)(H5,23,24,27,28,30) |
| InChIKey | GDAIRPOCTYXNFE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 160.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|