C23H29N5O6 — CID 20667119
methyl 3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]-2-methoxyphenyl]-2-(propan-2-yloxycarbonylamino)propanoate (PubChem CID 20667119) has the molecular formula C23H29N5O6 and a molecular weight of 471.51 g/mol. Its IUPAC name is methyl 3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]-2-methoxyphenyl]-2-(propan-2-yloxycarbonylamino)propanoate.
| Compound Name | methyl 3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]-2-methoxyphenyl]-2-(propan-2-yloxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 20667119 |
| Molecular Formula | C23H29N5O6 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | methyl 3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]-2-methoxyphenyl]-2-(propan-2-yloxycarbonylamino)propanoate |
| SMILES | COC(=O)C(Cc1ccc(NC(=O)c2cccc(N=C(N)N)c2)cc1OC)NC(=O)OC(C)C |
| InChI | InChI=1S/C23H29N5O6/c1-13(2)34-23(31)28-18(21(30)33-4)11-14-8-9-17(12-19(14)32-3)26-20(29)15-6-5-7-16(10-15)27-22(24)25/h5-10,12-13,18H,11H2,1-4H3,(H,26,29)(H,28,31)(H4,24,25,27) |
| InChIKey | LDANKPMIOBZKAH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 167.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|