C21H24ClN5O5 — CID 57472155
(2S)-3-[3-chloro-4-[[3-(diaminomethylideneamino)benzoyl]amino]phenyl]-2-(propan-2-yloxycarbonylamino)propanoic acid (PubChem CID 57472155) has the molecular formula C21H24ClN5O5 and a molecular weight of 461.91 g/mol. Its IUPAC name is (2S)-3-[3-chloro-4-[[3-(diaminomethylideneamino)benzoyl]amino]phenyl]-2-(propan-2-yloxycarbonylamino)propanoic acid.
| Compound Name | (2S)-3-[3-chloro-4-[[3-(diaminomethylideneamino)benzoyl]amino]phenyl]-2-(propan-2-yloxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 57472155 |
| Molecular Formula | C21H24ClN5O5 |
| Molecular Weight | 461.91 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | (2S)-3-[3-chloro-4-[[3-(diaminomethylideneamino)benzoyl]amino]phenyl]-2-(propan-2-yloxycarbonylamino)propanoic acid |
| SMILES | CC(C)OC(=O)N[C@@H](Cc1ccc(NC(=O)c2cccc(N=C(N)N)c2)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C21H24ClN5O5/c1-11(2)32-21(31)27-17(19(29)30)9-12-6-7-16(15(22)8-12)26-18(28)13-4-3-5-14(10-13)25-20(23)24/h3-8,10-11,17H,9H2,1-2H3,(H,26,28)(H,27,31)(H,29,30)(H4,23,24,25)/t17-/m0/s1 |
| InChIKey | MALKSXHZKLJZGJ-KRWDZBQOSA-N |
| XLogP | 2.63 |
| TPSA | 169.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.91 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|