C24H31N5O5 — CID 21191472
ethyl 3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 21191472) has the molecular formula C24H31N5O5 and a molecular weight of 469.54 g/mol. Its IUPAC name is ethyl 3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | ethyl 3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 21191472 |
| Molecular Formula | C24H31N5O5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | ethyl 3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(NC(=O)c2cccc(N=C(N)N)c2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H31N5O5/c1-5-33-21(31)19(29-23(32)34-24(2,3)4)13-15-9-11-17(12-10-15)27-20(30)16-7-6-8-18(14-16)28-22(25)26/h6-12,14,19H,5,13H2,1-4H3,(H,27,30)(H,29,32)(H4,25,26,28) |
| InChIKey | XBKZMLGZVUNYDK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 158.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|