C19H21N5O5 — CID 70071196
(2S)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-(methoxycarbonylamino)propanoic acid (PubChem CID 70071196) has the molecular formula C19H21N5O5 and a molecular weight of 399.41 g/mol. Its IUPAC name is (2S)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-(methoxycarbonylamino)propanoic acid.
| Compound Name | (2S)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-(methoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 70071196 |
| Molecular Formula | C19H21N5O5 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (2S)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-(methoxycarbonylamino)propanoic acid |
| SMILES | COC(=O)N[C@@H](Cc1ccc(NC(=O)c2cccc(/N=C/NN)c2)cc1)C(=O)O |
| InChI | InChI=1S/C19H21N5O5/c1-29-19(28)24-16(18(26)27)9-12-5-7-14(8-6-12)23-17(25)13-3-2-4-15(10-13)21-11-22-20/h2-8,10-11,16H,9,20H2,1H3,(H,21,22)(H,23,25)(H,24,28)(H,26,27)/t16-/m0/s1 |
| InChIKey | UCALCLSMHHIHRW-INIZCTEOSA-N |
| XLogP | 1.41 |
| TPSA | 155.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|