C22H26N6O5 — CID 70071906
(2S)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-(morpholine-4-carbonylamino)propanoic acid (PubChem CID 70071906) has the molecular formula C22H26N6O5 and a molecular weight of 454.49 g/mol. Its IUPAC name is (2S)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-(morpholine-4-carbonylamino)propanoic acid.
| Compound Name | (2S)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-(morpholine-4-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 70071906 |
| Molecular Formula | C22H26N6O5 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | (2S)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-(morpholine-4-carbonylamino)propanoic acid |
| SMILES | NN/C=N/c1cccc(C(=O)Nc2ccc(C[C@H](NC(=O)N3CCOCC3)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C22H26N6O5/c23-25-14-24-18-3-1-2-16(13-18)20(29)26-17-6-4-15(5-7-17)12-19(21(30)31)27-22(32)28-8-10-33-11-9-28/h1-7,13-14,19H,8-12,23H2,(H,24,25)(H,26,29)(H,27,32)(H,30,31)/t19-/m0/s1 |
| InChIKey | LMAYIJYGWKNYGE-IBGZPJMESA-N |
| XLogP | 1.10 |
| TPSA | 158.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|