C19H29N3O6 — CID 18631423
(2S)-2-aminopentanoic acid;(2S)-2-(morpholine-4-carbonylamino)-3-phenylpropanoic acid (PubChem CID 18631423) has the molecular formula C19H29N3O6 and a molecular weight of 395.46 g/mol. Its IUPAC name is (2S)-2-aminopentanoic acid;(2S)-2-(morpholine-4-carbonylamino)-3-phenylpropanoic acid.
| Compound Name | (2S)-2-aminopentanoic acid;(2S)-2-(morpholine-4-carbonylamino)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18631423 |
| Molecular Formula | C19H29N3O6 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | (2S)-2-aminopentanoic acid;(2S)-2-(morpholine-4-carbonylamino)-3-phenylpropanoic acid |
| SMILES | CCC[C@H](N)C(=O)O.O=C(O)[C@H](Cc1ccccc1)NC(=O)N1CCOCC1 |
| InChI | InChI=1S/C14H18N2O4.C5H11NO2/c17-13(18)12(10-11-4-2-1-3-5-11)15-14(19)16-6-8-20-9-7-16;1-2-3-4(6)5(7)8/h1-5,12H,6-10H2,(H,15,19)(H,17,18);4H,2-3,6H2,1H3,(H,7,8)/t12-;4-/m00/s1 |
| InChIKey | QZKMEHDGWQOLHV-GOYLBZKJSA-N |
| XLogP | 0.92 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |