C19H29BN3O6 — CID 68541836
CID 68541836 (PubChem CID 68541836) has the molecular formula C19H29BN3O6 and a molecular weight of 406.27 g/mol.
| Compound Name | CID 68541836 |
|---|---|
| PubChem CID | 68541836 |
| Molecular Formula | C19H29BN3O6 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | — |
| SMILES | CC(C)C[C@H](N)O[B]Oc1ccc(C[C@H](NC(=O)N2CCOCC2)C(=O)O)cc1 |
| InChI | InChI=1S/C19H29BN3O6/c1-13(2)11-17(21)29-20-28-15-5-3-14(4-6-15)12-16(18(24)25)22-19(26)23-7-9-27-10-8-23/h3-6,13,16-17H,7-12,21H2,1-2H3,(H,22,26)(H,24,25)/t16-,17+/m0/s1 |
| InChIKey | JNWYSTZBPJUKQO-DLBZAZTESA-N |
| XLogP | 0.98 |
| TPSA | 123.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|