C9H16N2O5 — CID 81077004
3-methoxy-2-(morpholine-4-carbonylamino)propanoic acid (PubChem CID 81077004) has the molecular formula C9H16N2O5 and a molecular weight of 232.24 g/mol. Its IUPAC name is 3-methoxy-2-(morpholine-4-carbonylamino)propanoic acid.
| Compound Name | 3-methoxy-2-(morpholine-4-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 81077004 |
| Molecular Formula | C9H16N2O5 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 3-methoxy-2-(morpholine-4-carbonylamino)propanoic acid |
| SMILES | COCC(NC(=O)N1CCOCC1)C(=O)O |
| InChI | InChI=1S/C9H16N2O5/c1-15-6-7(8(12)13)10-9(14)11-2-4-16-5-3-11/h7H,2-6H2,1H3,(H,10,14)(H,12,13) |
| InChIKey | GJGKEHOLPXWPLI-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |