C10H18N2O4S — CID 81084619
3-methoxy-2-(1,4-thiazepane-4-carbonylamino)propanoic acid (PubChem CID 81084619) has the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. Its IUPAC name is 3-methoxy-2-(1,4-thiazepane-4-carbonylamino)propanoic acid.
| Compound Name | 3-methoxy-2-(1,4-thiazepane-4-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 81084619 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 3-methoxy-2-(1,4-thiazepane-4-carbonylamino)propanoic acid |
| SMILES | COCC(NC(=O)N1CCCSCC1)C(=O)O |
| InChI | InChI=1S/C10H18N2O4S/c1-16-7-8(9(13)14)11-10(15)12-3-2-5-17-6-4-12/h8H,2-7H2,1H3,(H,11,15)(H,13,14) |
| InChIKey | YDHIZDQCJDXSPE-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |