3-methoxy-2-(1,4-thiazepane-4-carbonylamino)propanoic acid

C10H18N2O4S — CID 81084619

IUPAC3-methoxy-2-(1,4-thiazepane-4-carbonylamino)propanoic acid
SMILESCOCC(NC(=O)N1CCCSCC1)C(=O)O
InChIInChI=1S/C10H18N2O4S/c1-16-7-8(9(13)14)11-10(15)12-3-2-5-17-6-4-12/h8H,2-7H2,1H3,(H,11,15)(H,13,14)
InChIKeyYDHIZDQCJDXSPE-UHFFFAOYSA-N
MW262.33 g/mol
LogP0.23
Rot. Bonds4

About 3-methoxy-2-(1,4-thiazepane-4-carbonylamino)propanoic acid

3-methoxy-2-(1,4-thiazepane-4-carbonylamino)propanoic acid (PubChem CID 81084619) has the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. Its IUPAC name is 3-methoxy-2-(1,4-thiazepane-4-carbonylamino)propanoic acid.

Molecular Properties

Compound Name3-methoxy-2-(1,4-thiazepane-4-carbonylamino)propanoic acid
PubChem CID81084619
Molecular FormulaC10H18N2O4S
Molecular Weight262.33 g/mol
Exact Mass262.10
IUPAC Name3-methoxy-2-(1,4-thiazepane-4-carbonylamino)propanoic acid
SMILESCOCC(NC(=O)N1CCCSCC1)C(=O)O
InChIInChI=1S/C10H18N2O4S/c1-16-7-8(9(13)14)11-10(15)12-3-2-5-17-6-4-12/h8H,2-7H2,1H3,(H,11,15)(H,13,14)
InChIKeyYDHIZDQCJDXSPE-UHFFFAOYSA-N
XLogP0.23
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.33
LogP ≤ 50.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-methoxy-2-(1,4-thiazepane-4-carbonylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methoxy-2-(1,4-thiazepane-4-carbonylamino)propanoic acid?
The IUPAC name of 3-methoxy-2-(1,4-thiazepane-4-carbonylamino)propanoic acid (CID 81084619) is 3-methoxy-2-(1,4-thiazepane-4-carbonylamino)propanoic acid.
What is the SMILES notation for 3-methoxy-2-(1,4-thiazepane-4-carbonylamino)propanoic acid?
The canonical SMILES for 3-methoxy-2-(1,4-thiazepane-4-carbonylamino)propanoic acid is COCC(NC(=O)N1CCCSCC1)C(=O)O.
What is the InChIKey of 3-methoxy-2-(1,4-thiazepane-4-carbonylamino)propanoic acid?
The InChIKey is YDHIZDQCJDXSPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O4S/c1-16-7-8(9(13)14)11-10(15)12-3-2-5-17-6-4-12/h8H,2-7H2,1H3,(H,11,15)(H,13,14).
What are the key properties of 3-methoxy-2-(1,4-thiazepane-4-carbonylamino)propanoic acid?
3-methoxy-2-(1,4-thiazepane-4-carbonylamino)propanoic acid has a molecular weight of 262.33 g/mol, XLogP of 0.23, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2-(1,4-thiazepane-4-carbonylamino)propanoic acid is sourced from PubChem (CID 81084619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).