C11H21N3O4S — CID 106326224
3-methoxy-2-(2-thiomorpholin-4-ylethylcarbamoylamino)propanoic acid (PubChem CID 106326224) has the molecular formula C11H21N3O4S and a molecular weight of 291.37 g/mol. Its IUPAC name is 3-methoxy-2-(2-thiomorpholin-4-ylethylcarbamoylamino)propanoic acid.
| Compound Name | 3-methoxy-2-(2-thiomorpholin-4-ylethylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 106326224 |
| Molecular Formula | C11H21N3O4S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 3-methoxy-2-(2-thiomorpholin-4-ylethylcarbamoylamino)propanoic acid |
| SMILES | COCC(NC(=O)NCCN1CCSCC1)C(=O)O |
| InChI | InChI=1S/C11H21N3O4S/c1-18-8-9(10(15)16)13-11(17)12-2-3-14-4-6-19-7-5-14/h9H,2-8H2,1H3,(H,15,16)(H2,12,13,17) |
| InChIKey | NIXOXBXJSRNHBD-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |