C24H23N5O4 — CID 21191418
2-benzamido-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoic acid (PubChem CID 21191418) has the molecular formula C24H23N5O4 and a molecular weight of 445.48 g/mol. Its IUPAC name is 2-benzamido-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoic acid.
| Compound Name | 2-benzamido-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 21191418 |
| Molecular Formula | C24H23N5O4 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 2-benzamido-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoic acid |
| SMILES | NN/C=N/c1cccc(C(=O)Nc2ccc(CC(NC(=O)c3ccccc3)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C24H23N5O4/c25-27-15-26-20-8-4-7-18(14-20)23(31)28-19-11-9-16(10-12-19)13-21(24(32)33)29-22(30)17-5-2-1-3-6-17/h1-12,14-15,21H,13,25H2,(H,26,27)(H,28,31)(H,29,30)(H,32,33) |
| InChIKey | CPXOGTPDBTUNRM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|