C21H23N5O7 — CID 70059593
2-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-3-(7-methoxy-1,3-benzodioxol-5-yl)propanoic acid (PubChem CID 70059593) has the molecular formula C21H23N5O7 and a molecular weight of 457.44 g/mol. Its IUPAC name is 2-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-3-(7-methoxy-1,3-benzodioxol-5-yl)propanoic acid.
| Compound Name | 2-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-3-(7-methoxy-1,3-benzodioxol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 70059593 |
| Molecular Formula | C21H23N5O7 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 2-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-3-(7-methoxy-1,3-benzodioxol-5-yl)propanoic acid |
| SMILES | COc1cc(CC(NC(=O)CNC(=O)c2cccc(/N=C/NN)c2)C(=O)O)cc2c1OCO2 |
| InChI | InChI=1S/C21H23N5O7/c1-31-16-6-12(7-17-19(16)33-11-32-17)5-15(21(29)30)26-18(27)9-23-20(28)13-3-2-4-14(8-13)24-10-25-22/h2-4,6-8,10,15H,5,9,11,22H2,1H3,(H,23,28)(H,24,25)(H,26,27)(H,29,30) |
| InChIKey | DHIYUOMHDDOJCE-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 173.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|