C18H23N5O4S — CID 70060363
methyl 3-[3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-2H-thiophen-3-yl]propanoate (PubChem CID 70060363) has the molecular formula C18H23N5O4S and a molecular weight of 405.48 g/mol. Its IUPAC name is methyl 3-[3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-2H-thiophen-3-yl]propanoate.
| Compound Name | methyl 3-[3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-2H-thiophen-3-yl]propanoate |
|---|---|
| PubChem CID | 70060363 |
| Molecular Formula | C18H23N5O4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | methyl 3-[3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-2H-thiophen-3-yl]propanoate |
| SMILES | COC(=O)CCC1(NC(=O)CNC(=O)c2cccc(/N=C/NN)c2)C=CSC1 |
| InChI | InChI=1S/C18H23N5O4S/c1-27-16(25)5-6-18(7-8-28-11-18)23-15(24)10-20-17(26)13-3-2-4-14(9-13)21-12-22-19/h2-4,7-9,12H,5-6,10-11,19H2,1H3,(H,20,26)(H,21,22)(H,23,24) |
| InChIKey | UGBLJNLNOARQMF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|