C23H27N5O7 — CID 174397633
2-[2-[1-ethoxy-3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-1-oxopropan-2-yl]phenoxy]acetic acid (PubChem CID 174397633) has the molecular formula C23H27N5O7 and a molecular weight of 485.50 g/mol. Its IUPAC name is 2-[2-[1-ethoxy-3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-1-oxopropan-2-yl]phenoxy]acetic acid.
| Compound Name | 2-[2-[1-ethoxy-3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-1-oxopropan-2-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 174397633 |
| Molecular Formula | C23H27N5O7 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | 2-[2-[1-ethoxy-3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-1-oxopropan-2-yl]phenoxy]acetic acid |
| SMILES | CCOC(=O)C(CNC(=O)CNC(=O)c1cccc(/N=C/NN)c1)c1ccccc1OCC(=O)O |
| InChI | InChI=1S/C23H27N5O7/c1-2-34-23(33)18(17-8-3-4-9-19(17)35-13-21(30)31)11-25-20(29)12-26-22(32)15-6-5-7-16(10-15)27-14-28-24/h3-10,14,18H,2,11-13,24H2,1H3,(H,25,29)(H,26,32)(H,27,28)(H,30,31) |
| InChIKey | URTAGDCLJNYFGL-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 181.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|