C22H23Cl2N5O6 — CID 70059396
3-[[2-[[3-(3,5-dichlorophenyl)-1-ethoxy-1-oxopropan-2-yl]amino]-2-oxoethyl]carbamoyl]-5-(hydrazinylmethylideneamino)benzoic acid (PubChem CID 70059396) has the molecular formula C22H23Cl2N5O6 and a molecular weight of 524.36 g/mol. Its IUPAC name is 3-[[2-[[3-(3,5-dichlorophenyl)-1-ethoxy-1-oxopropan-2-yl]amino]-2-oxoethyl]carbamoyl]-5-(hydrazinylmethylideneamino)benzoic acid.
| Compound Name | 3-[[2-[[3-(3,5-dichlorophenyl)-1-ethoxy-1-oxopropan-2-yl]amino]-2-oxoethyl]carbamoyl]-5-(hydrazinylmethylideneamino)benzoic acid |
|---|---|
| PubChem CID | 70059396 |
| Molecular Formula | C22H23Cl2N5O6 |
| Molecular Weight | 524.36 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | 3-[[2-[[3-(3,5-dichlorophenyl)-1-ethoxy-1-oxopropan-2-yl]amino]-2-oxoethyl]carbamoyl]-5-(hydrazinylmethylideneamino)benzoic acid |
| SMILES | CCOC(=O)C(Cc1cc(Cl)cc(Cl)c1)NC(=O)CNC(=O)c1cc(/N=C/NN)cc(C(=O)O)c1 |
| InChI | InChI=1S/C22H23Cl2N5O6/c1-2-35-22(34)18(5-12-3-15(23)9-16(24)4-12)29-19(30)10-26-20(31)13-6-14(21(32)33)8-17(7-13)27-11-28-25/h3-4,6-9,11,18H,2,5,10,25H2,1H3,(H,26,31)(H,27,28)(H,29,30)(H,32,33) |
| InChIKey | ZRDFPBRGHMGBKN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 172.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|