C20H19Cl2N5O6 — CID 22608350
3-[[2-[[2-carboxy-1-(3,5-dichlorophenyl)ethyl]amino]-2-oxoethyl]carbamoyl]-5-(diaminomethylideneamino)benzoic acid (PubChem CID 22608350) has the molecular formula C20H19Cl2N5O6 and a molecular weight of 496.31 g/mol. Its IUPAC name is 3-[[2-[[2-carboxy-1-(3,5-dichlorophenyl)ethyl]amino]-2-oxoethyl]carbamoyl]-5-(diaminomethylideneamino)benzoic acid.
| Compound Name | 3-[[2-[[2-carboxy-1-(3,5-dichlorophenyl)ethyl]amino]-2-oxoethyl]carbamoyl]-5-(diaminomethylideneamino)benzoic acid |
|---|---|
| PubChem CID | 22608350 |
| Molecular Formula | C20H19Cl2N5O6 |
| Molecular Weight | 496.31 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | 3-[[2-[[2-carboxy-1-(3,5-dichlorophenyl)ethyl]amino]-2-oxoethyl]carbamoyl]-5-(diaminomethylideneamino)benzoic acid |
| SMILES | NC(N)=Nc1cc(C(=O)O)cc(C(=O)NCC(=O)NC(CC(=O)O)c2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C20H19Cl2N5O6/c21-12-2-9(3-13(22)6-12)15(7-17(29)30)27-16(28)8-25-18(31)10-1-11(19(32)33)5-14(4-10)26-20(23)24/h1-6,15H,7-8H2,(H,25,31)(H,27,28)(H,29,30)(H,32,33)(H4,23,24,26) |
| InChIKey | NXCADQJLHKUYAV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 197.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|