C20H19ClF3N5O5 — CID 20745323
3-(5-chloro-2-hydroxyphenyl)-3-[[2-[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]acetyl]amino]propanoic acid (PubChem CID 20745323) has the molecular formula C20H19ClF3N5O5 and a molecular weight of 501.85 g/mol. Its IUPAC name is 3-(5-chloro-2-hydroxyphenyl)-3-[[2-[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]acetyl]amino]propanoic acid.
| Compound Name | 3-(5-chloro-2-hydroxyphenyl)-3-[[2-[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 20745323 |
| Molecular Formula | C20H19ClF3N5O5 |
| Molecular Weight | 501.85 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | 3-(5-chloro-2-hydroxyphenyl)-3-[[2-[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]acetyl]amino]propanoic acid |
| SMILES | NC(N)=Nc1cc(C(=O)NCC(=O)NC(CC(=O)O)c2cc(Cl)ccc2O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19ClF3N5O5/c21-11-1-2-15(30)13(6-11)14(7-17(32)33)29-16(31)8-27-18(34)9-3-10(20(22,23)24)5-12(4-9)28-19(25)26/h1-6,14,30H,7-8H2,(H,27,34)(H,29,31)(H,32,33)(H4,25,26,28) |
| InChIKey | LCNQMCXJWDRVGE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 180.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.85 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|