C20H18Br2F3N5O4 — CID 70070302
3-[3,5-dibromo-2-[[2-[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]acetyl]amino]phenyl]propanoic acid (PubChem CID 70070302) has the molecular formula C20H18Br2F3N5O4 and a molecular weight of 609.20 g/mol. Its IUPAC name is 3-[3,5-dibromo-2-[[2-[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]acetyl]amino]phenyl]propanoic acid.
| Compound Name | 3-[3,5-dibromo-2-[[2-[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]acetyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 70070302 |
| Molecular Formula | C20H18Br2F3N5O4 |
| Molecular Weight | 609.20 g/mol |
| Exact Mass | 606.97 |
| IUPAC Name | 3-[3,5-dibromo-2-[[2-[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]acetyl]amino]phenyl]propanoic acid |
| SMILES | NC(N)=Nc1cc(C(=O)NCC(=O)Nc2c(Br)cc(Br)cc2CCC(=O)O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H18Br2F3N5O4/c21-12-4-9(1-2-16(32)33)17(14(22)7-12)30-15(31)8-28-18(34)10-3-11(20(23,24)25)6-13(5-10)29-19(26)27/h3-7H,1-2,8H2,(H,28,34)(H,30,31)(H,32,33)(H4,26,27,29) |
| InChIKey | FIYXGUGBIIKXEQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.20 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|