C21H21N5O5 — CID 70060057
3-[3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-1-benzofuran-2-yl]propanoic acid (PubChem CID 70060057) has the molecular formula C21H21N5O5 and a molecular weight of 423.43 g/mol. Its IUPAC name is 3-[3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-1-benzofuran-2-yl]propanoic acid.
| Compound Name | 3-[3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-1-benzofuran-2-yl]propanoic acid |
|---|---|
| PubChem CID | 70060057 |
| Molecular Formula | C21H21N5O5 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 3-[3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-1-benzofuran-2-yl]propanoic acid |
| SMILES | NC(N)=Nc1cccc(C(=O)NCC(=O)Nc2c(CCC(=O)O)oc3ccccc23)c1 |
| InChI | InChI=1S/C21H21N5O5/c22-21(23)25-13-5-3-4-12(10-13)20(30)24-11-17(27)26-19-14-6-1-2-7-15(14)31-16(19)8-9-18(28)29/h1-7,10H,8-9,11H2,(H,24,30)(H,26,27)(H,28,29)(H4,22,23,25) |
| InChIKey | PZJLLMVFBQHKBU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 173.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|