C26H25N5O4 — CID 90778594
3-[9-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-9H-fluoren-2-yl]propanoic acid (PubChem CID 90778594) has the molecular formula C26H25N5O4 and a molecular weight of 471.52 g/mol. Its IUPAC name is 3-[9-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-9H-fluoren-2-yl]propanoic acid.
| Compound Name | 3-[9-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-9H-fluoren-2-yl]propanoic acid |
|---|---|
| PubChem CID | 90778594 |
| Molecular Formula | C26H25N5O4 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 3-[9-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-9H-fluoren-2-yl]propanoic acid |
| SMILES | NC(N)=Nc1cccc(C(=O)NCC(=O)NC2c3ccccc3-c3ccc(CCC(=O)O)cc32)c1 |
| InChI | InChI=1S/C26H25N5O4/c27-26(28)30-17-5-3-4-16(13-17)25(35)29-14-22(32)31-24-20-7-2-1-6-18(20)19-10-8-15(12-21(19)24)9-11-23(33)34/h1-8,10,12-13,24H,9,11,14H2,(H,29,35)(H,31,32)(H,33,34)(H4,27,28,30) |
| InChIKey | XHEJEKZBEUYRFP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|