3-(9-amino-9H-fluoren-2-yl)propanoic acid

C16H15NO2 — CID 23227315

IUPAC3-(9-amino-9H-fluoren-2-yl)propanoic acid
SMILESNC1c2ccccc2-c2ccc(CCC(=O)O)cc21
InChIInChI=1S/C16H15NO2/c17-16-13-4-2-1-3-11(13)12-7-5-10(9-14(12)16)6-8-15(18)19/h1-5,7,9,16H,6,8,17H2,(H,18,19)
InChIKeyNREMPWRHPLVOIQ-UHFFFAOYSA-N
MW253.30 g/mol
LogP2.73
Rot. Bonds3

About 3-(9-amino-9H-fluoren-2-yl)propanoic acid

3-(9-amino-9H-fluoren-2-yl)propanoic acid (PubChem CID 23227315) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-(9-amino-9H-fluoren-2-yl)propanoic acid.

Molecular Properties

Compound Name3-(9-amino-9H-fluoren-2-yl)propanoic acid
PubChem CID23227315
Molecular FormulaC16H15NO2
Molecular Weight253.30 g/mol
Exact Mass253.11
IUPAC Name3-(9-amino-9H-fluoren-2-yl)propanoic acid
SMILESNC1c2ccccc2-c2ccc(CCC(=O)O)cc21
InChIInChI=1S/C16H15NO2/c17-16-13-4-2-1-3-11(13)12-7-5-10(9-14(12)16)6-8-15(18)19/h1-5,7,9,16H,6,8,17H2,(H,18,19)
InChIKeyNREMPWRHPLVOIQ-UHFFFAOYSA-N
XLogP2.73
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.30
LogP ≤ 52.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-(9-amino-9H-fluoren-2-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylphenyl]propanoic acid
CID 154810049
3-[4-(2-phenylethyl)phenyl]propanoic acid
CID 54586982
3-[9-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-9H-fluoren-2-yl]propanoic acid
CID 90778594
lanthanum;3-phenylpropanoic acid
CID 174887955
2-bromo-9H-fluoren-9-amine
CID 71174476
3-[(4R)-4-amino-3,4-dihydro-2H-chromen-6-yl]propanoic acid
CID 165354380
3-(14-hydroxy-3,10,21-trioxo-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4(9),5,7,15,17,19-octaen-6-yl)propanoic acid
CID 123154805
3-(3,4-dibenzoyloxyphenyl)propanoic acid
CID 19097459
3-[3,4-bis(2-carboxyethyl)phenyl]propanoic acid
CID 11119944
3-(3-hydroxyphenyl)propanoic acid;3-phenylpropanoic acid
CID 175603484
3-(3-hydroxy-3H-inden-1-yl)propanoic acid
CID 67403380
3-[3-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]propanoic acid
CID 18790661

Frequently Asked Questions

What is the IUPAC name of 3-(9-amino-9H-fluoren-2-yl)propanoic acid?
The IUPAC name of 3-(9-amino-9H-fluoren-2-yl)propanoic acid (CID 23227315) is 3-(9-amino-9H-fluoren-2-yl)propanoic acid.
What is the SMILES notation for 3-(9-amino-9H-fluoren-2-yl)propanoic acid?
The canonical SMILES for 3-(9-amino-9H-fluoren-2-yl)propanoic acid is NC1c2ccccc2-c2ccc(CCC(=O)O)cc21.
What is the InChIKey of 3-(9-amino-9H-fluoren-2-yl)propanoic acid?
The InChIKey is NREMPWRHPLVOIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO2/c17-16-13-4-2-1-3-11(13)12-7-5-10(9-14(12)16)6-8-15(18)19/h1-5,7,9,16H,6,8,17H2,(H,18,19).
What are the key properties of 3-(9-amino-9H-fluoren-2-yl)propanoic acid?
3-(9-amino-9H-fluoren-2-yl)propanoic acid has a molecular weight of 253.30 g/mol, XLogP of 2.73, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(9-amino-9H-fluoren-2-yl)propanoic acid is sourced from PubChem (CID 23227315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).