C23H14O6S — CID 123154805
3-(14-hydroxy-3,10,21-trioxo-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4(9),5,7,15,17,19-octaen-6-yl)propanoic acid (PubChem CID 123154805) has the molecular formula C23H14O6S and a molecular weight of 418.43 g/mol. Its IUPAC name is 3-(14-hydroxy-3,10,21-trioxo-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4(9),5,7,15,17,19-octaen-6-yl)propanoic acid.
| Compound Name | 3-(14-hydroxy-3,10,21-trioxo-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4(9),5,7,15,17,19-octaen-6-yl)propanoic acid |
|---|---|
| PubChem CID | 123154805 |
| Molecular Formula | C23H14O6S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 3-(14-hydroxy-3,10,21-trioxo-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4(9),5,7,15,17,19-octaen-6-yl)propanoic acid |
| SMILES | O=C(O)CCc1ccc2c(c1)C(=O)c1c(sc3c1C(=O)c1ccccc1C3O)C2=O |
| InChI | InChI=1S/C23H14O6S/c24-15(25)8-6-10-5-7-13-14(9-10)19(27)17-16-18(26)11-3-1-2-4-12(11)20(28)22(16)30-23(17)21(13)29/h1-5,7,9,20,28H,6,8H2,(H,24,25) |
| InChIKey | KVNGBBQQKVRNRS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|