C21H12O5S — CID 144562583
14-hydroxy-18-methoxy-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4,6,8,15(20),16,18-octaene-3,10,21-trione (PubChem CID 144562583) has the molecular formula C21H12O5S and a molecular weight of 376.39 g/mol. Its IUPAC name is 14-hydroxy-18-methoxy-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4,6,8,15(20),16,18-octaene-3,10,21-trione.
| Compound Name | 14-hydroxy-18-methoxy-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4,6,8,15(20),16,18-octaene-3,10,21-trione |
|---|---|
| PubChem CID | 144562583 |
| Molecular Formula | C21H12O5S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 14-hydroxy-18-methoxy-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4,6,8,15(20),16,18-octaene-3,10,21-trione |
| SMILES | COc1ccc2c(c1)C(=O)c1c(sc3c1C(=O)c1ccccc1C3=O)C2O |
| InChI | InChI=1S/C21H12O5S/c1-26-9-6-7-12-13(8-9)17(23)15-14-16(22)10-4-2-3-5-11(10)18(24)20(14)27-21(15)19(12)25/h2-8,19,25H,1H3 |
| InChIKey | WFVVXIIYYRAKFA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|