C21H11BrO6 — CID 135411073
3-bromo-2-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-6-methoxynaphthalene-1,4-dione (PubChem CID 135411073) has the molecular formula C21H11BrO6 and a molecular weight of 439.22 g/mol. Its IUPAC name is 3-bromo-2-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-6-methoxynaphthalene-1,4-dione.
| Compound Name | 3-bromo-2-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-6-methoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 135411073 |
| Molecular Formula | C21H11BrO6 |
| Molecular Weight | 439.22 g/mol |
| Exact Mass | 437.97 |
| IUPAC Name | 3-bromo-2-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-6-methoxynaphthalene-1,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)C(Br)=C(C1=C(O)c3ccccc3C(=O)C1=O)C2=O |
| InChI | InChI=1S/C21H11BrO6/c1-28-9-6-7-12-13(8-9)19(25)16(22)14(17(12)23)15-18(24)10-4-2-3-5-11(10)20(26)21(15)27/h2-8,24H,1H3 |
| InChIKey | SQZMUMNUYLRZAR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.22 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|