C18H14O5 — CID 10781237
3-(3,4-dimethoxyphenyl)-4-hydroxynaphthalene-1,2-dione (PubChem CID 10781237) has the molecular formula C18H14O5 and a molecular weight of 310.31 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-4-hydroxynaphthalene-1,2-dione.
| Compound Name | 3-(3,4-dimethoxyphenyl)-4-hydroxynaphthalene-1,2-dione |
|---|---|
| PubChem CID | 10781237 |
| Molecular Formula | C18H14O5 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-4-hydroxynaphthalene-1,2-dione |
| SMILES | COc1ccc(C2=C(O)c3ccccc3C(=O)C2=O)cc1OC |
| InChI | InChI=1S/C18H14O5/c1-22-13-8-7-10(9-14(13)23-2)15-16(19)11-5-3-4-6-12(11)17(20)18(15)21/h3-9,19H,1-2H3 |
| InChIKey | IVPLLUXYAZEKJE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|