C18H17NO4 — CID 15882763
3-amino-2-(3,4-dimethoxyphenyl)-5-methoxyinden-1-one (PubChem CID 15882763) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is 3-amino-2-(3,4-dimethoxyphenyl)-5-methoxyinden-1-one.
| Compound Name | 3-amino-2-(3,4-dimethoxyphenyl)-5-methoxyinden-1-one |
|---|---|
| PubChem CID | 15882763 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 3-amino-2-(3,4-dimethoxyphenyl)-5-methoxyinden-1-one |
| SMILES | COc1ccc2c(c1)C(N)=C(c1ccc(OC)c(OC)c1)C2=O |
| InChI | InChI=1S/C18H17NO4/c1-21-11-5-6-12-13(9-11)17(19)16(18(12)20)10-4-7-14(22-2)15(8-10)23-3/h4-9H,19H2,1-3H3 |
| InChIKey | JNSKJNKINOYYSP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|