C8H11NO5S — CID 56992916
(2,5-dimethoxyphenyl) sulfamate (PubChem CID 56992916) has the molecular formula C8H11NO5S and a molecular weight of 233.24 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl) sulfamate.
| Compound Name | (2,5-dimethoxyphenyl) sulfamate |
|---|---|
| PubChem CID | 56992916 |
| Molecular Formula | C8H11NO5S |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | (2,5-dimethoxyphenyl) sulfamate |
| SMILES | COc1ccc(OC)c(OS(N)(=O)=O)c1 |
| InChI | InChI=1S/C8H11NO5S/c1-12-6-3-4-7(13-2)8(5-6)14-15(9,10)11/h3-5H,1-2H3,(H2,9,10,11) |
| InChIKey | NEYICKVAZCFLLF-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |