C10H12F3NO4S — CID 114827630
1-(2,5-dimethoxyphenyl)-2,2,2-trifluoroethanesulfonamide (PubChem CID 114827630) has the molecular formula C10H12F3NO4S and a molecular weight of 299.27 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2,2,2-trifluoroethanesulfonamide.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2,2,2-trifluoroethanesulfonamide |
|---|---|
| PubChem CID | 114827630 |
| Molecular Formula | C10H12F3NO4S |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2,2,2-trifluoroethanesulfonamide |
| SMILES | COc1ccc(OC)c(C(C(F)(F)F)S(N)(=O)=O)c1 |
| InChI | InChI=1S/C10H12F3NO4S/c1-17-6-3-4-8(18-2)7(5-6)9(10(11,12)13)19(14,15)16/h3-5,9H,1-2H3,(H2,14,15,16) |
| InChIKey | VPOLHMDOOZCMSC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |