C10H11BrF3NO4S — CID 114827735
1-(2-bromo-4,5-dimethoxyphenyl)-2,2,2-trifluoroethanesulfonamide (PubChem CID 114827735) has the molecular formula C10H11BrF3NO4S and a molecular weight of 378.17 g/mol. Its IUPAC name is 1-(2-bromo-4,5-dimethoxyphenyl)-2,2,2-trifluoroethanesulfonamide.
| Compound Name | 1-(2-bromo-4,5-dimethoxyphenyl)-2,2,2-trifluoroethanesulfonamide |
|---|---|
| PubChem CID | 114827735 |
| Molecular Formula | C10H11BrF3NO4S |
| Molecular Weight | 378.17 g/mol |
| Exact Mass | 376.95 |
| IUPAC Name | 1-(2-bromo-4,5-dimethoxyphenyl)-2,2,2-trifluoroethanesulfonamide |
| SMILES | COc1cc(Br)c(C(C(F)(F)F)S(N)(=O)=O)cc1OC |
| InChI | InChI=1S/C10H11BrF3NO4S/c1-18-7-3-5(6(11)4-8(7)19-2)9(10(12,13)14)20(15,16)17/h3-4,9H,1-2H3,(H2,15,16,17) |
| InChIKey | BUNRUKPFTLNGAK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.17 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |