C9H9BrF3NO3S — CID 114827602
1-(3-bromo-4-methoxyphenyl)-2,2,2-trifluoroethanesulfonamide (PubChem CID 114827602) has the molecular formula C9H9BrF3NO3S and a molecular weight of 348.14 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)-2,2,2-trifluoroethanesulfonamide.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)-2,2,2-trifluoroethanesulfonamide |
|---|---|
| PubChem CID | 114827602 |
| Molecular Formula | C9H9BrF3NO3S |
| Molecular Weight | 348.14 g/mol |
| Exact Mass | 346.94 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)-2,2,2-trifluoroethanesulfonamide |
| SMILES | COc1ccc(C(C(F)(F)F)S(N)(=O)=O)cc1Br |
| InChI | InChI=1S/C9H9BrF3NO3S/c1-17-7-3-2-5(4-6(7)10)8(9(11,12)13)18(14,15)16/h2-4,8H,1H3,(H2,14,15,16) |
| InChIKey | IDDOMUAKQDTGSA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.14 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |