C8H6BrF4NO2S — CID 114827624
1-(4-bromo-3-fluorophenyl)-2,2,2-trifluoroethanesulfonamide (PubChem CID 114827624) has the molecular formula C8H6BrF4NO2S and a molecular weight of 336.10 g/mol. Its IUPAC name is 1-(4-bromo-3-fluorophenyl)-2,2,2-trifluoroethanesulfonamide.
| Compound Name | 1-(4-bromo-3-fluorophenyl)-2,2,2-trifluoroethanesulfonamide |
|---|---|
| PubChem CID | 114827624 |
| Molecular Formula | C8H6BrF4NO2S |
| Molecular Weight | 336.10 g/mol |
| Exact Mass | 334.92 |
| IUPAC Name | 1-(4-bromo-3-fluorophenyl)-2,2,2-trifluoroethanesulfonamide |
| SMILES | NS(=O)(=O)C(c1ccc(Br)c(F)c1)C(F)(F)F |
| InChI | InChI=1S/C8H6BrF4NO2S/c9-5-2-1-4(3-6(5)10)7(8(11,12)13)17(14,15)16/h1-3,7H,(H2,14,15,16) |
| InChIKey | VBMVCTVHHOHPEI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.10 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |