C9H8F5NO2S — CID 114827661
1-[4-(difluoromethyl)phenyl]-2,2,2-trifluoroethanesulfonamide (PubChem CID 114827661) has the molecular formula C9H8F5NO2S and a molecular weight of 289.23 g/mol. Its IUPAC name is 1-[4-(difluoromethyl)phenyl]-2,2,2-trifluoroethanesulfonamide.
| Compound Name | 1-[4-(difluoromethyl)phenyl]-2,2,2-trifluoroethanesulfonamide |
|---|---|
| PubChem CID | 114827661 |
| Molecular Formula | C9H8F5NO2S |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 1-[4-(difluoromethyl)phenyl]-2,2,2-trifluoroethanesulfonamide |
| SMILES | NS(=O)(=O)C(c1ccc(C(F)F)cc1)C(F)(F)F |
| InChI | InChI=1S/C9H8F5NO2S/c10-8(11)6-3-1-5(2-4-6)7(9(12,13)14)18(15,16)17/h1-4,7-8H,(H2,15,16,17) |
| InChIKey | SZRBCYWNTGKWDM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |