C8H9F3N2O2S — CID 114827746
2,2,2-trifluoro-1-(4-methyl-3-pyridinyl)ethanesulfonamide (PubChem CID 114827746) has the molecular formula C8H9F3N2O2S and a molecular weight of 254.23 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(4-methyl-3-pyridinyl)ethanesulfonamide.
| Compound Name | 2,2,2-trifluoro-1-(4-methyl-3-pyridinyl)ethanesulfonamide |
|---|---|
| PubChem CID | 114827746 |
| Molecular Formula | C8H9F3N2O2S |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 2,2,2-trifluoro-1-(4-methyl-3-pyridinyl)ethanesulfonamide |
| SMILES | Cc1ccncc1C(C(F)(F)F)S(N)(=O)=O |
| InChI | InChI=1S/C8H9F3N2O2S/c1-5-2-3-13-4-6(5)7(8(9,10)11)16(12,14)15/h2-4,7H,1H3,(H2,12,14,15) |
| InChIKey | JCCBIVYLADRRJW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |