C10H12F3NO2S — CID 114827613
1-(2,4-dimethylphenyl)-2,2,2-trifluoroethanesulfonamide (PubChem CID 114827613) has the molecular formula C10H12F3NO2S and a molecular weight of 267.27 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-2,2,2-trifluoroethanesulfonamide.
| Compound Name | 1-(2,4-dimethylphenyl)-2,2,2-trifluoroethanesulfonamide |
|---|---|
| PubChem CID | 114827613 |
| Molecular Formula | C10H12F3NO2S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-2,2,2-trifluoroethanesulfonamide |
| SMILES | Cc1ccc(C(C(F)(F)F)S(N)(=O)=O)c(C)c1 |
| InChI | InChI=1S/C10H12F3NO2S/c1-6-3-4-8(7(2)5-6)9(10(11,12)13)17(14,15)16/h3-5,9H,1-2H3,(H2,14,15,16) |
| InChIKey | VVSHCGMGNKMYHE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |