C18H19F3INO2S — CID 102436863
N-[(R)-(2,4-dimethylphenyl)-(2-iodo-4,6-dimethylphenyl)methyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 102436863) has the molecular formula C18H19F3INO2S and a molecular weight of 497.32 g/mol. Its IUPAC name is N-[(R)-(2,4-dimethylphenyl)-(2-iodo-4,6-dimethylphenyl)methyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[(R)-(2,4-dimethylphenyl)-(2-iodo-4,6-dimethylphenyl)methyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 102436863 |
| Molecular Formula | C18H19F3INO2S |
| Molecular Weight | 497.32 g/mol |
| Exact Mass | 497.01 |
| IUPAC Name | N-[(R)-(2,4-dimethylphenyl)-(2-iodo-4,6-dimethylphenyl)methyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | Cc1ccc([C@@H](NS(=O)(=O)C(F)(F)F)c2c(C)cc(C)cc2I)c(C)c1 |
| InChI | InChI=1S/C18H19F3INO2S/c1-10-5-6-14(12(3)7-10)17(23-26(24,25)18(19,20)21)16-13(4)8-11(2)9-15(16)22/h5-9,17,23H,1-4H3/t17-/m1/s1 |
| InChIKey | RXZQKAUZXOEEIY-QGZVFWFLSA-N |
| XLogP | 5.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.32 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|