About 2-[bis(trifluoromethylsulfonyl)methyl]-1,3,5-trimethylbenzene
2-[bis(trifluoromethylsulfonyl)methyl]-1,3,5-trimethylbenzene (PubChem CID 162172435) has the molecular formula C24H24F12O8S4
and a molecular weight of 796.69 g/mol. Its IUPAC name is 2-[bis(trifluoromethylsulfonyl)methyl]-1,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | 2-[bis(trifluoromethylsulfonyl)methyl]-1,3,5-trimethylbenzene |
| PubChem CID | 162172435 |
| Molecular Formula | C24H24F12O8S4 |
| Molecular Weight | 796.69 g/mol |
| Exact Mass | 796.02 |
| IUPAC Name | 2-[bis(trifluoromethylsulfonyl)methyl]-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(C(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)c(C)c1.Cc1cc(C)c(C(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/2C12H12F6O4S2/c2*1-6-4-7(2)9(8(3)5-6)10(23(19,20)11(13,14)15)24(21,22)12(16,17)18/h2*4-5,10H,1-3H3 |
| InChIKey | ZNYUCCCMFNSRGC-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 136.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 796.69 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[bis(trifluoromethylsulfonyl)methyl]-1,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(trifluoromethylsulfonyl)methyl]-1,3,5-trimethylbenzene?
The IUPAC name of 2-[bis(trifluoromethylsulfonyl)methyl]-1,3,5-trimethylbenzene (CID 162172435) is 2-[bis(trifluoromethylsulfonyl)methyl]-1,3,5-trimethylbenzene.
What is the SMILES notation for 2-[bis(trifluoromethylsulfonyl)methyl]-1,3,5-trimethylbenzene?
The canonical SMILES for 2-[bis(trifluoromethylsulfonyl)methyl]-1,3,5-trimethylbenzene is Cc1cc(C)c(C(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)c(C)c1.Cc1cc(C)c(C(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)c(C)c1.
What is the InChIKey of 2-[bis(trifluoromethylsulfonyl)methyl]-1,3,5-trimethylbenzene?
The InChIKey is ZNYUCCCMFNSRGC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H12F6O4S2/c2*1-6-4-7(2)9(8(3)5-6)10(23(19,20)11(13,14)15)24(21,22)12(16,17)18/h2*4-5,10H,1-3H3.
What are the key properties of 2-[bis(trifluoromethylsulfonyl)methyl]-1,3,5-trimethylbenzene?
2-[bis(trifluoromethylsulfonyl)methyl]-1,3,5-trimethylbenzene has a molecular weight of 796.69 g/mol, XLogP of 6.96, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(trifluoromethylsulfonyl)methyl]-1,3,5-trimethylbenzene is sourced from PubChem (CID 162172435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).