C24H24F12O8S4 — CID 162172435
2-[bis(trifluoromethylsulfonyl)methyl]-1,3,5-trimethylbenzene (PubChem CID 162172435) has the molecular formula C24H24F12O8S4 and a molecular weight of 796.69 g/mol. Its IUPAC name is 2-[bis(trifluoromethylsulfonyl)methyl]-1,3,5-trimethylbenzene.
| Compound Name | 2-[bis(trifluoromethylsulfonyl)methyl]-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 162172435 |
| Molecular Formula | C24H24F12O8S4 |
| Molecular Weight | 796.69 g/mol |
| Exact Mass | 796.02 |
| IUPAC Name | 2-[bis(trifluoromethylsulfonyl)methyl]-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(C(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)c(C)c1.Cc1cc(C)c(C(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/2C12H12F6O4S2/c2*1-6-4-7(2)9(8(3)5-6)10(23(19,20)11(13,14)15)24(21,22)12(16,17)18/h2*4-5,10H,1-3H3 |
| InChIKey | ZNYUCCCMFNSRGC-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 136.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.69 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |