C10H14O4S — CID 103574351
hydroxy-(2,4,6-trimethylphenyl)methanesulfonic acid (PubChem CID 103574351) has the molecular formula C10H14O4S and a molecular weight of 230.28 g/mol. Its IUPAC name is hydroxy-(2,4,6-trimethylphenyl)methanesulfonic acid.
| Compound Name | hydroxy-(2,4,6-trimethylphenyl)methanesulfonic acid |
|---|---|
| PubChem CID | 103574351 |
| Molecular Formula | C10H14O4S |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | hydroxy-(2,4,6-trimethylphenyl)methanesulfonic acid |
| SMILES | Cc1cc(C)c(C(O)S(=O)(=O)O)c(C)c1 |
| InChI | InChI=1S/C10H14O4S/c1-6-4-7(2)9(8(3)5-6)10(11)15(12,13)14/h4-5,10-11H,1-3H3,(H,12,13,14) |
| InChIKey | WLWIIIBULDQHCO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|