C9H14O3S — CID 90820463
trihydroxy-(2,4,6-trimethylphenyl)-λ4-sulfane (PubChem CID 90820463) has the molecular formula C9H14O3S and a molecular weight of 202.27 g/mol. Its IUPAC name is trihydroxy-(2,4,6-trimethylphenyl)-λ4-sulfane.
| Compound Name | trihydroxy-(2,4,6-trimethylphenyl)-λ4-sulfane |
|---|---|
| PubChem CID | 90820463 |
| Molecular Formula | C9H14O3S |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | trihydroxy-(2,4,6-trimethylphenyl)-λ4-sulfane |
| SMILES | Cc1cc(C)c(S(O)(O)O)c(C)c1 |
| InChI | InChI=1S/C9H14O3S/c1-6-4-7(2)9(8(3)5-6)13(10,11)12/h4-5,10-12H,1-3H3 |
| InChIKey | YYFAEQOXSHGWQG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |