C11H17NO3S — CID 117037386
2-amino-1-(2,4,6-trimethylphenyl)sulfonylethanol (PubChem CID 117037386) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-amino-1-(2,4,6-trimethylphenyl)sulfonylethanol.
| Compound Name | 2-amino-1-(2,4,6-trimethylphenyl)sulfonylethanol |
|---|---|
| PubChem CID | 117037386 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-amino-1-(2,4,6-trimethylphenyl)sulfonylethanol |
| SMILES | Cc1cc(C)c(S(=O)(=O)C(O)CN)c(C)c1 |
| InChI | InChI=1S/C11H17NO3S/c1-7-4-8(2)11(9(3)5-7)16(14,15)10(13)6-12/h4-5,10,13H,6,12H2,1-3H3 |
| InChIKey | WTOVSFSYWPVPJI-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |