C10H15NO5S — CID 117037392
2-amino-1-(3,4-dimethoxyphenyl)sulfonylethanol (PubChem CID 117037392) has the molecular formula C10H15NO5S and a molecular weight of 261.30 g/mol. Its IUPAC name is 2-amino-1-(3,4-dimethoxyphenyl)sulfonylethanol.
| Compound Name | 2-amino-1-(3,4-dimethoxyphenyl)sulfonylethanol |
|---|---|
| PubChem CID | 117037392 |
| Molecular Formula | C10H15NO5S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-amino-1-(3,4-dimethoxyphenyl)sulfonylethanol |
| SMILES | COc1ccc(S(=O)(=O)C(O)CN)cc1OC |
| InChI | InChI=1S/C10H15NO5S/c1-15-8-4-3-7(5-9(8)16-2)17(13,14)10(12)6-11/h3-5,10,12H,6,11H2,1-2H3 |
| InChIKey | OTWCBDKDKVDFDT-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |