C16H27NO7S — CID 70127286
2-(3,4-dimethoxyphenyl)sulfonyloctanoic acid;hydroxylamine (PubChem CID 70127286) has the molecular formula C16H27NO7S and a molecular weight of 377.46 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)sulfonyloctanoic acid;hydroxylamine.
| Compound Name | 2-(3,4-dimethoxyphenyl)sulfonyloctanoic acid;hydroxylamine |
|---|---|
| PubChem CID | 70127286 |
| Molecular Formula | C16H27NO7S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)sulfonyloctanoic acid;hydroxylamine |
| SMILES | CCCCCCC(C(=O)O)S(=O)(=O)c1ccc(OC)c(OC)c1.NO |
| InChI | InChI=1S/C16H24O6S.H3NO/c1-4-5-6-7-8-15(16(17)18)23(19,20)12-9-10-13(21-2)14(11-12)22-3;1-2/h9-11,15H,4-8H2,1-3H3,(H,17,18);2H,1H2 |
| InChIKey | QQKDFBYXTIJDDK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|