C21H34O5S — CID 139784297
3-(2-methoxy-4-propylsulfonylphenyl)undecanoic acid (PubChem CID 139784297) has the molecular formula C21H34O5S and a molecular weight of 398.57 g/mol. Its IUPAC name is 3-(2-methoxy-4-propylsulfonylphenyl)undecanoic acid.
| Compound Name | 3-(2-methoxy-4-propylsulfonylphenyl)undecanoic acid |
|---|---|
| PubChem CID | 139784297 |
| Molecular Formula | C21H34O5S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 3-(2-methoxy-4-propylsulfonylphenyl)undecanoic acid |
| SMILES | CCCCCCCCC(CC(=O)O)c1ccc(S(=O)(=O)CCC)cc1OC |
| InChI | InChI=1S/C21H34O5S/c1-4-6-7-8-9-10-11-17(15-21(22)23)19-13-12-18(16-20(19)26-3)27(24,25)14-5-2/h12-13,16-17H,4-11,14-15H2,1-3H3,(H,22,23) |
| InChIKey | HZNFYEWHKYUNEC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|