C18H28O5S — CID 19348452
3-(2-methoxy-4-propan-2-ylsulfonylphenyl)octanoic acid (PubChem CID 19348452) has the molecular formula C18H28O5S and a molecular weight of 356.48 g/mol. Its IUPAC name is 3-(2-methoxy-4-propan-2-ylsulfonylphenyl)octanoic acid.
| Compound Name | 3-(2-methoxy-4-propan-2-ylsulfonylphenyl)octanoic acid |
|---|---|
| PubChem CID | 19348452 |
| Molecular Formula | C18H28O5S |
| Molecular Weight | 356.48 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 3-(2-methoxy-4-propan-2-ylsulfonylphenyl)octanoic acid |
| SMILES | CCCCCC(CC(=O)O)c1ccc(S(=O)(=O)C(C)C)cc1OC |
| InChI | InChI=1S/C18H28O5S/c1-5-6-7-8-14(11-18(19)20)16-10-9-15(12-17(16)23-4)24(21,22)13(2)3/h9-10,12-14H,5-8,11H2,1-4H3,(H,19,20) |
| InChIKey | HDVXEABCYBXSRS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|